C20H15BrN2O4 — CID 3390375
5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-1-(2-hydroxyethyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 3390375) has the molecular formula C20H15BrN2O4 and a molecular weight of 427.25 g/mol. Its IUPAC name is 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-1-(2-hydroxyethyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-1-(2-hydroxyethyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3390375 |
| Molecular Formula | C20H15BrN2O4 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-1-(2-hydroxyethyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(CCO)C(=O)C1=Cc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C20H15BrN2O4/c1-12-16(19(25)23(8-9-24)20(26)17(12)11-22)10-15-6-7-18(27-15)13-2-4-14(21)5-3-13/h2-7,10,24H,8-9H2,1H3 |
| InChIKey | JQVNEWWCLNNRBG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|