C26H24N2O8 — CID 50886622
diethyl 5-[5-[(E)-[5-cyano-1-(2-hydroxyethyl)-4-methyl-2,6-dioxo-3-pyridinylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylate (PubChem CID 50886622) has the molecular formula C26H24N2O8 and a molecular weight of 492.48 g/mol. Its IUPAC name is diethyl 5-[5-[(E)-[5-cyano-1-(2-hydroxyethyl)-4-methyl-2,6-dioxo-3-pyridinylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[5-[(E)-[5-cyano-1-(2-hydroxyethyl)-4-methyl-2,6-dioxo-3-pyridinylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 50886622 |
| Molecular Formula | C26H24N2O8 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | diethyl 5-[5-[(E)-[5-cyano-1-(2-hydroxyethyl)-4-methyl-2,6-dioxo-3-pyridinylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)cc(-c2ccc(/C=C3/C(=O)N(CCO)C(=O)C(C#N)=C3C)o2)c1 |
| InChI | InChI=1S/C26H24N2O8/c1-4-34-25(32)17-10-16(11-18(12-17)26(33)35-5-2)22-7-6-19(36-22)13-20-15(3)21(14-27)24(31)28(8-9-29)23(20)30/h6-7,10-13,29H,4-5,8-9H2,1-3H3/b20-13+ |
| InChIKey | LGLYQMXTUGYMGF-DEDYPNTBSA-N |
| XLogP | 2.88 |
| TPSA | 147.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|