C22H18N2O5 — CID 19109473
ethyl 4-[5-[(E)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate (PubChem CID 19109473) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 19109473 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | ethyl 4-[5-[(E)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C3/C(=O)N(C)C(=O)C(C#N)=C3C)o2)cc1 |
| InChI | InChI=1S/C22H18N2O5/c1-4-28-22(27)15-7-5-14(6-8-15)19-10-9-16(29-19)11-17-13(2)18(12-23)21(26)24(3)20(17)25/h5-11H,4H2,1-3H3/b17-11+ |
| InChIKey | WEJUZFWCWJZOHX-GZTJUZNOSA-N |
| XLogP | 3.35 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|