C23H20N2O5 — CID 1007579
propan-2-yl 4-[5-[(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate (PubChem CID 1007579) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is propan-2-yl 4-[5-[(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | propan-2-yl 4-[5-[(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 1007579 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | propan-2-yl 4-[5-[(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)C1=Cc1ccc(-c2ccc(C(=O)OC(C)C)cc2)o1 |
| InChI | InChI=1S/C23H20N2O5/c1-13(2)29-23(28)16-7-5-15(6-8-16)20-10-9-17(30-20)11-18-14(3)19(12-24)22(27)25(4)21(18)26/h5-11,13H,1-4H3 |
| InChIKey | ZCDLIKBCWVIAGM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|