C19H13BrN2O3 — CID 6375058
(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 6375058) has the molecular formula C19H13BrN2O3 and a molecular weight of 397.23 g/mol. Its IUPAC name is (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6375058 |
| Molecular Formula | C19H13BrN2O3 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)/C1=C/c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C19H13BrN2O3/c1-11-15(18(23)22(2)19(24)16(11)10-21)9-14-7-8-17(25-14)12-3-5-13(20)6-4-12/h3-9H,1-2H3/b15-9+ |
| InChIKey | USENQCATDSMHEC-OQLLNIDSSA-N |
| XLogP | 3.93 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|