C19H15N3O5S — CID 50883722
4-[5-[(E)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzenesulfonamide (PubChem CID 50883722) has the molecular formula C19H15N3O5S and a molecular weight of 397.41 g/mol. Its IUPAC name is 4-[5-[(E)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzenesulfonamide.
| Compound Name | 4-[5-[(E)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 50883722 |
| Molecular Formula | C19H15N3O5S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-[5-[(E)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzenesulfonamide |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)/C1=C/c1ccc(-c2ccc(S(N)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C19H15N3O5S/c1-11-15(18(23)22(2)19(24)16(11)10-20)9-13-5-8-17(27-13)12-3-6-14(7-4-12)28(21,25)26/h3-9H,1-2H3,(H2,21,25,26)/b15-9+ |
| InChIKey | WQLNPLIAWAWJCY-OQLLNIDSSA-N |
| XLogP | 1.82 |
| TPSA | 134.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|