C27H19ClN2O5 — CID 50886447
(2-chlorophenyl)methyl 4-[5-[(Z)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate (PubChem CID 50886447) has the molecular formula C27H19ClN2O5 and a molecular weight of 486.91 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 4-[5-[(Z)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | (2-chlorophenyl)methyl 4-[5-[(Z)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50886447 |
| Molecular Formula | C27H19ClN2O5 |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (2-chlorophenyl)methyl 4-[5-[(Z)-(5-cyano-1,4-dimethyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzoate |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)/C1=C\c1ccc(-c2ccc(C(=O)OCc3ccccc3Cl)cc2)o1 |
| InChI | InChI=1S/C27H19ClN2O5/c1-16-21(25(31)30(2)26(32)22(16)14-29)13-20-11-12-24(35-20)17-7-9-18(10-8-17)27(33)34-15-19-5-3-4-6-23(19)28/h3-13H,15H2,1-2H3/b21-13- |
| InChIKey | JIJSQJMFISTABD-BKUYFWCQSA-N |
| XLogP | 5.18 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|