C26H19BrN2O3 — CID 19112657
(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-4-methyl-1-[(4-methylphenyl)methyl]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112657) has the molecular formula C26H19BrN2O3 and a molecular weight of 487.35 g/mol. Its IUPAC name is (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-4-methyl-1-[(4-methylphenyl)methyl]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-4-methyl-1-[(4-methylphenyl)methyl]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112657 |
| Molecular Formula | C26H19BrN2O3 |
| Molecular Weight | 487.35 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-4-methyl-1-[(4-methylphenyl)methyl]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2ccc(C)cc2)C(=O)/C1=C/c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C26H19BrN2O3/c1-16-3-5-18(6-4-16)15-29-25(30)22(17(2)23(14-28)26(29)31)13-21-11-12-24(32-21)19-7-9-20(27)10-8-19/h3-13H,15H2,1-2H3/b22-13+ |
| InChIKey | YEXCAIXHRLZGCW-LPYMAVHISA-N |
| XLogP | 5.81 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.35 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|