C21H14Cl2N2O3 — CID 19112088
(5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-prop-2-enylpyridine-3-carbonitrile (PubChem CID 19112088) has the molecular formula C21H14Cl2N2O3 and a molecular weight of 413.26 g/mol. Its IUPAC name is (5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-prop-2-enylpyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-prop-2-enylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112088 |
| Molecular Formula | C21H14Cl2N2O3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxo-1-prop-2-enylpyridine-3-carbonitrile |
| SMILES | C=CCN1C(=O)C(C#N)=C(C)/C(=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)C1=O |
| InChI | InChI=1S/C21H14Cl2N2O3/c1-3-8-25-20(26)15(12(2)16(11-24)21(25)27)10-14-5-7-19(28-14)13-4-6-17(22)18(23)9-13/h3-7,9-10H,1,8H2,2H3/b15-10+ |
| InChIKey | WMGUCGFNRAYIBL-XNTDXEJSSA-N |
| XLogP | 5.03 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|