C22H16N2O5 — CID 3291567
3-[5-[(5-cyano-4-methyl-2,6-dioxo-1-prop-2-enyl-3-pyridinylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 3291567) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is 3-[5-[(5-cyano-4-methyl-2,6-dioxo-1-prop-2-enyl-3-pyridinylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(5-cyano-4-methyl-2,6-dioxo-1-prop-2-enyl-3-pyridinylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3291567 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[5-[(5-cyano-4-methyl-2,6-dioxo-1-prop-2-enyl-3-pyridinylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(-c3cccc(C(=O)O)c3)o2)C(C)=C(C#N)C1=O |
| InChI | InChI=1S/C22H16N2O5/c1-3-9-24-20(25)17(13(2)18(12-23)21(24)26)11-16-7-8-19(29-16)14-5-4-6-15(10-14)22(27)28/h3-8,10-11H,1,9H2,2H3,(H,27,28) |
| InChIKey | FEBJJTNJFPRXSW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|