C22H17NO4 — CID 126123771
3-[5-[(Z)-(1-ethyl-2-oxoindol-3-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 126123771) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-[5-[(Z)-(1-ethyl-2-oxoindol-3-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(Z)-(1-ethyl-2-oxoindol-3-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126123771 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3-[5-[(Z)-(1-ethyl-2-oxoindol-3-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | CCN1C(=O)/C(=C\c2ccc(-c3cccc(C(=O)O)c3)o2)c2ccccc21 |
| InChI | InChI=1S/C22H17NO4/c1-2-23-19-9-4-3-8-17(19)18(21(23)24)13-16-10-11-20(27-16)14-6-5-7-15(12-14)22(25)26/h3-13H,2H2,1H3,(H,25,26)/b18-13- |
| InChIKey | NQCXYRMZDAGBID-AQTBWJFISA-N |
| XLogP | 4.55 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|