C19H17N2O4S- — CID 7364284
3-[5-[(Z)-(1,3-diethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 7364284) has the molecular formula C19H17N2O4S- and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-[5-[(Z)-(1,3-diethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(Z)-(1,3-diethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7364284 |
| Molecular Formula | C19H17N2O4S- |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 3-[5-[(Z)-(1,3-diethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | CCN1C(=O)/C(=C/c2ccc(-c3cccc(C(=O)[O-])c3)o2)N(CC)C1=S |
| InChI | InChI=1S/C19H18N2O4S/c1-3-20-15(17(22)21(4-2)19(20)26)11-14-8-9-16(25-14)12-6-5-7-13(10-12)18(23)24/h5-11H,3-4H2,1-2H3,(H,23,24)/p-1/b15-11- |
| InChIKey | ZKYQMMPDUISYSM-PTNGSMBKSA-M |
| XLogP | 2.12 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|