C22H15N2O5- — CID 7321399
3-[5-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 7321399) has the molecular formula C22H15N2O5- and a molecular weight of 387.37 g/mol. Its IUPAC name is 3-[5-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7321399 |
| Molecular Formula | C22H15N2O5- |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-[5-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | O=C([O-])c1cccc(-c2ccc(/C=C3\NC(=O)N(Cc4ccccc4)C3=O)o2)c1 |
| InChI | InChI=1S/C22H16N2O5/c25-20-18(23-22(28)24(20)13-14-5-2-1-3-6-14)12-17-9-10-19(29-17)15-7-4-8-16(11-15)21(26)27/h1-12H,13H2,(H,23,28)(H,26,27)/p-1/b18-12- |
| InChIKey | TWALHXHOOIFRGH-PDGQHHTCSA-M |
| XLogP | 2.40 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|