C21H15ClN2O6 — CID 6184448
methyl 5-[[(4Z)-4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 6184448) has the molecular formula C21H15ClN2O6 and a molecular weight of 426.81 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 6184448 |
| Molecular Formula | C21H15ClN2O6 |
| Molecular Weight | 426.81 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3ccc(-c4cccc(Cl)c4)o3)C2=O)o1 |
| InChI | InChI=1S/C21H15ClN2O6/c1-28-20(26)18-8-6-15(30-18)11-24-19(25)16(23-21(24)27)10-14-5-7-17(29-14)12-3-2-4-13(22)9-12/h2-10H,11H2,1H3,(H,23,27)/b16-10- |
| InChIKey | WAJMIXPUNMOLFF-YBEGLDIGSA-N |
| XLogP | 4.07 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|