C23H19Cl2NO2 — CID 126127322
(3Z)-3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-1-(2-methylpropyl)indol-2-one (PubChem CID 126127322) has the molecular formula C23H19Cl2NO2 and a molecular weight of 412.32 g/mol. Its IUPAC name is (3Z)-3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-1-(2-methylpropyl)indol-2-one.
| Compound Name | (3Z)-3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-1-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 126127322 |
| Molecular Formula | C23H19Cl2NO2 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (3Z)-3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-1-(2-methylpropyl)indol-2-one |
| SMILES | CC(C)CN1C(=O)/C(=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c2ccccc21 |
| InChI | InChI=1S/C23H19Cl2NO2/c1-14(2)13-26-21-6-4-3-5-17(21)18(23(26)27)12-16-8-10-22(28-16)15-7-9-19(24)20(25)11-15/h3-12,14H,13H2,1-2H3/b18-12- |
| InChIKey | VDQFFSMZJIEYLE-PDGQHHTCSA-N |
| XLogP | 6.80 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|