C21H22ClNO3 — CID 126118417
(3Z)-3-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-1-(2-methylpropyl)indol-2-one (PubChem CID 126118417) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is (3Z)-3-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-1-(2-methylpropyl)indol-2-one.
| Compound Name | (3Z)-3-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-1-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 126118417 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (3Z)-3-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-1-(2-methylpropyl)indol-2-one |
| SMILES | COc1cc(Cl)c(/C=C2\C(=O)N(CC(C)C)c3ccccc32)cc1OC |
| InChI | InChI=1S/C21H22ClNO3/c1-13(2)12-23-18-8-6-5-7-15(18)16(21(23)24)9-14-10-19(25-3)20(26-4)11-17(14)22/h5-11,13H,12H2,1-4H3/b16-9- |
| InChIKey | KDKUCZDNXVULTR-SXGWCWSVSA-N |
| XLogP | 4.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|