C25H25ClN2O — CID 126116199
(3Z)-3-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2-methylpropyl)indol-2-one (PubChem CID 126116199) has the molecular formula C25H25ClN2O and a molecular weight of 404.94 g/mol. Its IUPAC name is (3Z)-3-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2-methylpropyl)indol-2-one.
| Compound Name | (3Z)-3-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 126116199 |
| Molecular Formula | C25H25ClN2O |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (3Z)-3-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-(2-methylpropyl)indol-2-one |
| SMILES | Cc1cc(/C=C2\C(=O)N(CC(C)C)c3ccccc32)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClN2O/c1-16(2)15-27-24-8-6-5-7-22(24)23(25(27)29)14-19-13-17(3)28(18(19)4)21-11-9-20(26)10-12-21/h5-14,16H,15H2,1-4H3/b23-14- |
| InChIKey | NBPZMNAPGJACIS-UCQKPKSFSA-N |
| XLogP | 6.29 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|