C23H20Cl2N2O — CID 126204997
(3E)-3-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethylindol-2-one (PubChem CID 126204997) has the molecular formula C23H20Cl2N2O and a molecular weight of 411.33 g/mol. Its IUPAC name is (3E)-3-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethylindol-2-one.
| Compound Name | (3E)-3-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethylindol-2-one |
|---|---|
| PubChem CID | 126204997 |
| Molecular Formula | C23H20Cl2N2O |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (3E)-3-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethylindol-2-one |
| SMILES | CCN1C(=O)/C(=C/c2cc(C)n(-c3cccc(Cl)c3Cl)c2C)c2ccccc21 |
| InChI | InChI=1S/C23H20Cl2N2O/c1-4-26-20-10-6-5-8-17(20)18(23(26)28)13-16-12-14(2)27(15(16)3)21-11-7-9-19(24)22(21)25/h5-13H,4H2,1-3H3/b18-13+ |
| InChIKey | FGESCQOLYXEJPB-QGOAFFKASA-N |
| XLogP | 6.31 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|