C26H25N3OS — CID 126199327
2-[3-[(E)-(1-ethyl-2-oxoindol-3-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126199327) has the molecular formula C26H25N3OS and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[3-[(E)-(1-ethyl-2-oxoindol-3-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[3-[(E)-(1-ethyl-2-oxoindol-3-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126199327 |
| Molecular Formula | C26H25N3OS |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-[3-[(E)-(1-ethyl-2-oxoindol-3-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CCN1C(=O)/C(=C/c2cc(C)n(-c3sc4c(c3C#N)CCCC4)c2C)c2ccccc21 |
| InChI | InChI=1S/C26H25N3OS/c1-4-28-23-11-7-5-9-19(23)21(25(28)30)14-18-13-16(2)29(17(18)3)26-22(15-27)20-10-6-8-12-24(20)31-26/h5,7,9,11,13-14H,4,6,8,10,12H2,1-3H3/b21-14+ |
| InChIKey | BQQAJPVCGAAIMA-KGENOOAVSA-N |
| XLogP | 5.81 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|