C26H24N4OS — CID 1354776
(E)-N-benzyl-2-cyano-3-[1-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide (PubChem CID 1354776) has the molecular formula C26H24N4OS and a molecular weight of 440.57 g/mol. Its IUPAC name is (E)-N-benzyl-2-cyano-3-[1-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-2-cyano-3-[1-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1354776 |
| Molecular Formula | C26H24N4OS |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (E)-N-benzyl-2-cyano-3-[1-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)NCc2ccccc2)c(C)n1-c1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C26H24N4OS/c1-17-12-20(13-21(14-27)25(31)29-16-19-8-4-3-5-9-19)18(2)30(17)26-23(15-28)22-10-6-7-11-24(22)32-26/h3-5,8-9,12-13H,6-7,10-11,16H2,1-2H3,(H,29,31)/b21-13+ |
| InChIKey | YFCDNEFYAWEFPX-FYJGNVAPSA-N |
| XLogP | 5.13 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|