C30H28N4O3S — CID 3761024
2-[3-[2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 3761024) has the molecular formula C30H28N4O3S and a molecular weight of 524.65 g/mol. Its IUPAC name is 2-[3-[2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-[2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 3761024 |
| Molecular Formula | C30H28N4O3S |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 2-[3-[2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)NCc2ccco2)c(C)n1-c1sc2c(c1C(=O)Nc1ccccc1)CCCC2 |
| InChI | InChI=1S/C30H28N4O3S/c1-19-15-21(16-22(17-31)28(35)32-18-24-11-8-14-37-24)20(2)34(19)30-27(25-12-6-7-13-26(25)38-30)29(36)33-23-9-4-3-5-10-23/h3-5,8-11,14-16H,6-7,12-13,18H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | UYVBADUFXWFGEJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|