C27H27N3O3S — CID 4678980
2-[3-[2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (PubChem CID 4678980) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-[3-[2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[3-[2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 4678980 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-[3-[2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3sc4c(c3C(=O)O)CCCC4)c2C)c(C)c1 |
| InChI | InChI=1S/C27H27N3O3S/c1-15-9-10-22(16(2)11-15)29-25(31)20(14-28)13-19-12-17(3)30(18(19)4)26-24(27(32)33)21-7-5-6-8-23(21)34-26/h9-13H,5-8H2,1-4H3,(H,29,31)(H,32,33) |
| InChIKey | ULIKCZMTWFMORJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|