C26H24N4OS — CID 4676171
2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]prop-2-enamide (PubChem CID 4676171) has the molecular formula C26H24N4OS and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4676171 |
| Molecular Formula | C26H24N4OS |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cccc(-n2c(C)cc(C=C(C#N)C(=O)Nc3sc4c(c3C#N)CCCC4)c2C)c1 |
| InChI | InChI=1S/C26H24N4OS/c1-16-7-6-8-21(11-16)30-17(2)12-19(18(30)3)13-20(14-27)25(31)29-26-23(15-28)22-9-4-5-10-24(22)32-26/h6-8,11-13H,4-5,9-10H2,1-3H3,(H,29,31) |
| InChIKey | RFKXDCZOUTWNAX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|