C22H17ClF3N3O2 — CID 2080601
(E)-3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 2080601) has the molecular formula C22H17ClF3N3O2 and a molecular weight of 447.84 g/mol. Its IUPAC name is (E)-3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 2080601 |
| Molecular Formula | C22H17ClF3N3O2 |
| Molecular Weight | 447.84 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | (E)-3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)NCc2ccco2)c(C)n1-c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17ClF3N3O2/c1-13-8-15(9-16(11-27)21(30)28-12-18-4-3-7-31-18)14(2)29(13)17-5-6-20(23)19(10-17)22(24,25)26/h3-10H,12H2,1-2H3,(H,28,30)/b16-9+ |
| InChIKey | OYGVQNQPAMDRLW-CXUHLZMHSA-N |
| XLogP | 5.58 |
| TPSA | 70.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.84 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|