C27H19ClF3N3O3 — CID 2441734
[2-(1H-indol-3-yl)-2-oxoethyl] (Z)-3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate (PubChem CID 2441734) has the molecular formula C27H19ClF3N3O3 and a molecular weight of 525.91 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] (Z)-3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] (Z)-3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 2441734 |
| Molecular Formula | C27H19ClF3N3O3 |
| Molecular Weight | 525.91 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] (Z)-3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)OCC(=O)c2c[nH]c3ccccc23)c(C)n1-c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H19ClF3N3O3/c1-15-9-17(16(2)34(15)19-7-8-23(28)22(11-19)27(29,30)31)10-18(12-32)26(36)37-14-25(35)21-13-33-24-6-4-3-5-20(21)24/h3-11,13,33H,14H2,1-2H3/b18-10- |
| InChIKey | TYGFDUSORBOPRG-ZDLGFXPLSA-N |
| XLogP | 6.58 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.91 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|