C29H31Cl2N3O3 — CID 2496657
[2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 2496657) has the molecular formula C29H31Cl2N3O3 and a molecular weight of 540.49 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2496657 |
| Molecular Formula | C29H31Cl2N3O3 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OCC(=O)c2cc(C)n(-c3ccc(Cl)c(Cl)c3)c2C)c(C)n1CCC(C)C |
| InChI | InChI=1S/C29H31Cl2N3O3/c1-17(2)9-10-33-18(3)11-22(20(33)5)13-23(15-32)29(36)37-16-28(35)25-12-19(4)34(21(25)6)24-7-8-26(30)27(31)14-24/h7-8,11-14,17H,9-10,16H2,1-6H3/b23-13+ |
| InChIKey | DVJKSLUWKPUEBA-YDZHTSKRSA-N |
| XLogP | 7.20 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|