C21H30N4O4 — CID 7557572
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 7557572) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7557572 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OCC(=O)NC(=O)NC(C)C)c(C)n1CCC(C)C |
| InChI | InChI=1S/C21H30N4O4/c1-13(2)7-8-25-15(5)9-17(16(25)6)10-18(11-22)20(27)29-12-19(26)24-21(28)23-14(3)4/h9-10,13-14H,7-8,12H2,1-6H3,(H2,23,24,26,28)/b18-10+ |
| InChIKey | QROXUEUCRDDZAM-VCHYOVAHSA-N |
| XLogP | 2.84 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|