C29H35N3O7 — CID 3603672
diethyl 5-[[2-[2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 3603672) has the molecular formula C29H35N3O7 and a molecular weight of 537.61 g/mol. Its IUPAC name is diethyl 5-[[2-[2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[[2-[2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3603672 |
| Molecular Formula | C29H35N3O7 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | diethyl 5-[[2-[2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)COC(=O)C(C#N)=Cc2cc(C)n(CCC(C)C)c2C)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C29H35N3O7/c1-7-37-27(34)22-13-23(28(35)38-8-2)15-25(14-22)31-26(33)17-39-29(36)24(16-30)12-21-11-19(5)32(20(21)6)10-9-18(3)4/h11-15,18H,7-10,17H2,1-6H3,(H,31,33) |
| InChIKey | SIRHZTQQQACPIJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|