C20H14ClF3N4OS — CID 4012103
3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 4012103) has the molecular formula C20H14ClF3N4OS and a molecular weight of 450.87 g/mol. Its IUPAC name is 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4012103 |
| Molecular Formula | C20H14ClF3N4OS |
| Molecular Weight | 450.87 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)Nc2nccs2)c(C)n1-c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H14ClF3N4OS/c1-11-7-13(8-14(10-25)18(29)27-19-26-5-6-30-19)12(2)28(11)15-3-4-17(21)16(9-15)20(22,23)24/h3-9H,1-2H3,(H,26,27,29) |
| InChIKey | IYENPHHEJJVNEN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.87 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|