C20H18N4OS — CID 170913286
(Z)-3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170913286) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is (Z)-3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170913286 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (Z)-3-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)Nc2nccs2)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H18N4OS/c1-14-10-17(15(2)24(14)13-16-6-4-3-5-7-16)11-18(12-21)19(25)23-20-22-8-9-26-20/h3-11H,13H2,1-2H3,(H,22,23,25)/b18-11- |
| InChIKey | VOBXKNLQXDVDQM-WQRHYEAKSA-N |
| XLogP | 4.16 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|