C17H12ClN5OS — CID 9446836
(E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 9446836) has the molecular formula C17H12ClN5OS and a molecular weight of 369.84 g/mol. Its IUPAC name is (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9446836 |
| Molecular Formula | C17H12ClN5OS |
| Molecular Weight | 369.84 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=C(\C#N)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C17H12ClN5OS/c1-11-14(15(18)23(22-11)13-5-3-2-4-6-13)9-12(10-19)16(24)21-17-20-7-8-25-17/h2-9H,1H3,(H,20,21,24)/b12-9+ |
| InChIKey | JKVZJUQMUXZIEI-FMIVXFBMSA-N |
| XLogP | 3.84 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.84 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|