C20H12Cl4N4O — CID 3884810
3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide (PubChem CID 3884810) has the molecular formula C20H12Cl4N4O and a molecular weight of 466.16 g/mol. Its IUPAC name is 3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide.
| Compound Name | 3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3884810 |
| Molecular Formula | C20H12Cl4N4O |
| Molecular Weight | 466.16 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | 3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c(Cl)c1C=C(C#N)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H12Cl4N4O/c1-11-15(19(24)28(27-11)14-5-2-4-13(21)9-14)8-12(10-25)20(29)26-17-7-3-6-16(22)18(17)23/h2-9H,1H3,(H,26,29) |
| InChIKey | JMSJHJGDZNACTD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.16 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|