C21H15ClN4O3 — CID 18284746
4-[[(E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 18284746) has the molecular formula C21H15ClN4O3 and a molecular weight of 406.83 g/mol. Its IUPAC name is 4-[[(E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18284746 |
| Molecular Formula | C21H15ClN4O3 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 4-[[(E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=C(\C#N)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H15ClN4O3/c1-13-18(19(22)26(25-13)17-5-3-2-4-6-17)11-15(12-23)20(27)24-16-9-7-14(8-10-16)21(28)29/h2-11H,1H3,(H,24,27)(H,28,29)/b15-11+ |
| InChIKey | CMBYETCLQJWEBP-RVDMUPIBSA-N |
| XLogP | 4.08 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|