C21H14ClF3N4O — CID 166403522
(E)-3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 166403522) has the molecular formula C21H14ClF3N4O and a molecular weight of 430.82 g/mol. Its IUPAC name is (E)-3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | (E)-3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 166403522 |
| Molecular Formula | C21H14ClF3N4O |
| Molecular Weight | 430.82 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | (E)-3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(Cl)c1/C=C(\C#N)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H14ClF3N4O/c1-13-18(10-14(12-26)20(30)27-16-7-3-2-4-8-16)19(22)29(28-13)17-9-5-6-15(11-17)21(23,24)25/h2-11H,1H3,(H,27,30)/b14-10+ |
| InChIKey | JKMNWDIZFMVSDH-GXDHUFHOSA-N |
| XLogP | 5.40 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.82 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|