C22H14ClF5N4OS — CID 4022534
3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 4022534) has the molecular formula C22H14ClF5N4OS and a molecular weight of 512.89 g/mol. Its IUPAC name is 3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | 3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4022534 |
| Molecular Formula | C22H14ClF5N4OS |
| Molecular Weight | 512.89 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(Cl)c1C=C(C#N)C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C22H14ClF5N4OS/c1-12-18(19(23)32(31-12)16-4-2-3-14(10-16)22(26,27)28)9-13(11-29)20(33)30-15-5-7-17(8-6-15)34-21(24)25/h2-10,21H,1H3,(H,30,33) |
| InChIKey | KSDDLFDYTCHPQL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.89 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|