C20H12Cl2F3N5O — CID 166424795
(E)-3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-N-(4-chloro-2-pyridinyl)-2-cyanoprop-2-enamide (PubChem CID 166424795) has the molecular formula C20H12Cl2F3N5O and a molecular weight of 466.25 g/mol. Its IUPAC name is (E)-3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-N-(4-chloro-2-pyridinyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-N-(4-chloro-2-pyridinyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 166424795 |
| Molecular Formula | C20H12Cl2F3N5O |
| Molecular Weight | 466.25 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | (E)-3-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]-N-(4-chloro-2-pyridinyl)-2-cyanoprop-2-enamide |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(Cl)c1/C=C(\C#N)C(=O)Nc1cc(Cl)ccn1 |
| InChI | InChI=1S/C20H12Cl2F3N5O/c1-11-16(7-12(10-26)19(31)28-17-9-14(21)5-6-27-17)18(22)30(29-11)15-4-2-3-13(8-15)20(23,24)25/h2-9H,1H3,(H,27,28,31)/b12-7+ |
| InChIKey | CLYUHZNTTTWACU-KPKJPENVSA-N |
| XLogP | 5.45 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.25 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|