C14H8Cl2N4 — CID 2635616
2-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylidene]propanedinitrile (PubChem CID 2635616) has the molecular formula C14H8Cl2N4 and a molecular weight of 303.15 g/mol. Its IUPAC name is 2-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 2635616 |
| Molecular Formula | C14H8Cl2N4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylidene]propanedinitrile |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c(Cl)c1C=C(C#N)C#N |
| InChI | InChI=1S/C14H8Cl2N4/c1-9-13(5-10(7-17)8-18)14(16)20(19-9)12-4-2-3-11(15)6-12/h2-6H,1H3 |
| InChIKey | LNZLGAKFWFHJKQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|