C15H12N4 — CID 3771083
2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]propanedinitrile (PubChem CID 3771083) has the molecular formula C15H12N4 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 3771083 |
| Molecular Formula | C15H12N4 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]propanedinitrile |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C=C(C#N)C#N |
| InChI | InChI=1S/C15H12N4/c1-11-15(8-13(9-16)10-17)12(2)19(18-11)14-6-4-3-5-7-14/h3-8H,1-2H3 |
| InChIKey | GFZLCKBOGLAIGP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|