C17H16N4 — CID 126002164
2-[[1-(2,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]methylidene]propanedinitrile (PubChem CID 126002164) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[[1-(2,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[1-(2,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 126002164 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-[[1-(2,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]methylidene]propanedinitrile |
| SMILES | Cc1ccc(-n2nc(C)c(C=C(C#N)C#N)c2C)c(C)c1 |
| InChI | InChI=1S/C17H16N4/c1-11-5-6-17(12(2)7-11)21-14(4)16(13(3)20-21)8-15(9-18)10-19/h5-8H,1-4H3 |
| InChIKey | AVYYYDLWOCNOJB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|