C21H15F2N3O — CID 9337477
(E)-2-(2-fluorobenzoyl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 9337477) has the molecular formula C21H15F2N3O and a molecular weight of 363.37 g/mol. Its IUPAC name is (E)-2-(2-fluorobenzoyl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(2-fluorobenzoyl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 9337477 |
| Molecular Formula | C21H15F2N3O |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (E)-2-(2-fluorobenzoyl)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1/C=C(\C#N)C(=O)c1ccccc1F |
| InChI | InChI=1S/C21H15F2N3O/c1-13-19(14(2)26(25-13)17-9-7-16(22)8-10-17)11-15(12-24)21(27)18-5-3-4-6-20(18)23/h3-11H,1-2H3/b15-11+ |
| InChIKey | UMFWBUCDFHJHEU-RVDMUPIBSA-N |
| XLogP | 4.56 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|