C14H10Cl2N4O — CID 4543971
3-[5-chloro-1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyanoprop-2-enamide (PubChem CID 4543971) has the molecular formula C14H10Cl2N4O and a molecular weight of 321.17 g/mol. Its IUPAC name is 3-[5-chloro-1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyanoprop-2-enamide.
| Compound Name | 3-[5-chloro-1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 4543971 |
| Molecular Formula | C14H10Cl2N4O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 3-[5-chloro-1-(4-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyanoprop-2-enamide |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c(Cl)c1C=C(C#N)C(N)=O |
| InChI | InChI=1S/C14H10Cl2N4O/c1-8-12(6-9(7-17)14(18)21)13(16)20(19-8)11-4-2-10(15)3-5-11/h2-6H,1H3,(H2,18,21) |
| InChIKey | ILDGQQZQVBDKDR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|