C20H13Cl2FN4O — CID 3599697
3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyano-N-(4-fluorophenyl)prop-2-enamide (PubChem CID 3599697) has the molecular formula C20H13Cl2FN4O and a molecular weight of 415.26 g/mol. Its IUPAC name is 3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyano-N-(4-fluorophenyl)prop-2-enamide.
| Compound Name | 3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyano-N-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3599697 |
| Molecular Formula | C20H13Cl2FN4O |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-cyano-N-(4-fluorophenyl)prop-2-enamide |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c(Cl)c1C=C(C#N)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H13Cl2FN4O/c1-12-18(19(22)27(26-12)17-4-2-3-14(21)10-17)9-13(11-24)20(28)25-16-7-5-15(23)6-8-16/h2-10H,1H3,(H,25,28) |
| InChIKey | FPCHZCOLBFFFJI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|