C11H11FN2O3S — CID 87530789
1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-sulfonic acid (PubChem CID 87530789) has the molecular formula C11H11FN2O3S and a molecular weight of 270.28 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-sulfonic acid.
| Compound Name | 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-sulfonic acid |
|---|---|
| PubChem CID | 87530789 |
| Molecular Formula | C11H11FN2O3S |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-sulfonic acid |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1S(=O)(=O)O |
| InChI | InChI=1S/C11H11FN2O3S/c1-7-11(18(15,16)17)8(2)14(13-7)10-5-3-9(12)4-6-10/h3-6H,1-2H3,(H,15,16,17) |
| InChIKey | HTBKDTAQSUGVLT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|