C12H13FN4OS — CID 88812381
1-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-1-sulfanylurea (PubChem CID 88812381) has the molecular formula C12H13FN4OS and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-1-sulfanylurea.
| Compound Name | 1-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-1-sulfanylurea |
|---|---|
| PubChem CID | 88812381 |
| Molecular Formula | C12H13FN4OS |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-1-sulfanylurea |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1N(S)C(N)=O |
| InChI | InChI=1S/C12H13FN4OS/c1-7-11(17(19)12(14)18)8(2)16(15-7)10-5-3-9(13)4-6-10/h3-6,19H,1-2H3,(H2,14,18) |
| InChIKey | HKSZMJBVWXXELP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|