C18H12Cl2N4 — CID 4056061
3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile (PubChem CID 4056061) has the molecular formula C18H12Cl2N4 and a molecular weight of 355.23 g/mol. Its IUPAC name is 3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile.
| Compound Name | 3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 4056061 |
| Molecular Formula | C18H12Cl2N4 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 3-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]-2-pyridin-2-ylprop-2-enenitrile |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c(Cl)c1C=C(C#N)c1ccccn1 |
| InChI | InChI=1S/C18H12Cl2N4/c1-12-16(9-13(11-21)17-7-2-3-8-22-17)18(20)24(23-12)15-6-4-5-14(19)10-15/h2-10H,1H3 |
| InChIKey | DWIVMUOCTKCOGQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|