C17H16N2 — CID 3473649
2-pyridin-2-yl-3-(2,4,6-trimethylphenyl)prop-2-enenitrile (PubChem CID 3473649) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-pyridin-2-yl-3-(2,4,6-trimethylphenyl)prop-2-enenitrile.
| Compound Name | 2-pyridin-2-yl-3-(2,4,6-trimethylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3473649 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-pyridin-2-yl-3-(2,4,6-trimethylphenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C)c(C=C(C#N)c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C17H16N2/c1-12-8-13(2)16(14(3)9-12)10-15(11-18)17-6-4-5-7-19-17/h4-10H,1-3H3 |
| InChIKey | XTQCNMONINRPRU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|