C14H8Br2N2O — CID 135615702
(Z)-3-(3,5-dibromo-2-hydroxyphenyl)-2-pyridin-2-ylprop-2-enenitrile (PubChem CID 135615702) has the molecular formula C14H8Br2N2O and a molecular weight of 380.04 g/mol. Its IUPAC name is (Z)-3-(3,5-dibromo-2-hydroxyphenyl)-2-pyridin-2-ylprop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dibromo-2-hydroxyphenyl)-2-pyridin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 135615702 |
| Molecular Formula | C14H8Br2N2O |
| Molecular Weight | 380.04 g/mol |
| Exact Mass | 377.90 |
| IUPAC Name | (Z)-3-(3,5-dibromo-2-hydroxyphenyl)-2-pyridin-2-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Br)cc(Br)c1O)c1ccccn1 |
| InChI | InChI=1S/C14H8Br2N2O/c15-11-6-9(14(19)12(16)7-11)5-10(8-17)13-3-1-2-4-18-13/h1-7,19H/b10-5+ |
| InChIKey | OIXGILGQLXNJQZ-BJMVGYQFSA-N |
| XLogP | 4.38 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.04 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|