C15H8Br2N2O3 — CID 1365157
(Z)-3-(3,5-dibromo-2-hydroxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 1365157) has the molecular formula C15H8Br2N2O3 and a molecular weight of 424.05 g/mol. Its IUPAC name is (Z)-3-(3,5-dibromo-2-hydroxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dibromo-2-hydroxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1365157 |
| Molecular Formula | C15H8Br2N2O3 |
| Molecular Weight | 424.05 g/mol |
| Exact Mass | 421.89 |
| IUPAC Name | (Z)-3-(3,5-dibromo-2-hydroxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Br)cc(Br)c1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H8Br2N2O3/c16-12-6-10(15(20)14(17)7-12)5-11(8-18)9-1-3-13(4-2-9)19(21)22/h1-7,20H/b11-5+ |
| InChIKey | ZPUVRYBJVOJBOQ-VZUCSPMQSA-N |
| XLogP | 4.89 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.05 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|