C21H10Br2N4O7 — CID 126099083
(Z)-3-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126099083) has the molecular formula C21H10Br2N4O7 and a molecular weight of 590.14 g/mol. Its IUPAC name is (Z)-3-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126099083 |
| Molecular Formula | C21H10Br2N4O7 |
| Molecular Weight | 590.14 g/mol |
| Exact Mass | 587.89 |
| IUPAC Name | (Z)-3-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Br)cc(Br)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H10Br2N4O7/c22-15-8-13(7-14(11-24)12-1-3-16(4-2-12)25(28)29)21(18(23)9-15)34-20-6-5-17(26(30)31)10-19(20)27(32)33/h1-10H/b14-7+ |
| InChIKey | WJAIEXZFWLVDRW-VGOFMYFVSA-N |
| XLogP | 6.79 |
| TPSA | 162.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.14 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|