C21H11ClN4O7 — CID 126097214
(Z)-3-[5-chloro-2-(2,4-dinitrophenoxy)phenyl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126097214) has the molecular formula C21H11ClN4O7 and a molecular weight of 466.79 g/mol. Its IUPAC name is (Z)-3-[5-chloro-2-(2,4-dinitrophenoxy)phenyl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[5-chloro-2-(2,4-dinitrophenoxy)phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126097214 |
| Molecular Formula | C21H11ClN4O7 |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | (Z)-3-[5-chloro-2-(2,4-dinitrophenoxy)phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Cl)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H11ClN4O7/c22-16-3-7-20(33-21-8-6-18(25(29)30)11-19(21)26(31)32)14(10-16)9-15(12-23)13-1-4-17(5-2-13)24(27)28/h1-11H/b15-9+ |
| InChIKey | QSMSNIDMXPJTHP-OQLLNIDSSA-N |
| XLogP | 5.92 |
| TPSA | 162.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|